* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-TYR-LYS-THR-OH |
CAS: | 155943-09-2 |
English Synonyms: | L-TYR-LYS-THR ; H-TYR-LYS-THR-OH |
MDL Number.: | MFCD00238243 |
H bond acceptor: | 10 |
H bond donor: | 7 |
Smile: | C[C@H]([C@@H](C(=O)O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](Cc1ccc(cc1)O)N)O |
InChi: | InChI=1S/C19H30N4O6/c1-11(24)16(19(28)29)23-18(27)15(4-2-3-9-20)22-17(26)14(21)10-12-5-7-13(25)8-6-12/h5-8,11,14-16,24-25H,2-4,9-10,20-21H2,1H3,(H,22,26)(H,23,27)(H,28,29)/t11-,14+,15+,16+/m1/s1 |
InChiKey: | InChIKey=SINRIKQYQJRGDQ-MEYUZBJRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.