* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDAN-1,2-DIONE-2-OXIME |
| CAS: | 15028-10-1 |
| English Synonyms: | INDAN-1,2-DIONE-2-OXIME ; 1H-INDENE-1,2(3H)-DIONE 2-OXIME ; 1,2-INDANDIONE 2-OXIME |
| MDL Number.: | MFCD00463407 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)C/C(=N/O)/C2=O |
| InChi: | InChI=1S/C9H7NO2/c11-9-7-4-2-1-3-6(7)5-8(9)10-12/h1-4,12H,5H2/b10-8- |
| InChiKey: | InChIKey=CWEXMSPEUDRDPH-NTMALXAHSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.