* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INDAN-1,2-DIONE-2-OXIME |
CAS: | 15028-10-1 |
English Synonyms: | 1H-INDENE-1,2(3H)-DIONE 2-OXIME ; INDAN-1,2-DIONE-2-OXIME ; 1,2-INDANDIONE 2-OXIME |
MDL Number.: | MFCD00463407 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C/C(=N/O)/C2=O |
InChi: | InChI=1S/C9H7NO2/c11-9-7-4-2-1-3-6(7)5-8(9)10-12/h1-4,12H,5H2/b10-8- |
InChiKey: | InChIKey=CWEXMSPEUDRDPH-NTMALXAHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.