* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | D-BETA-T-BUTYLSERINE |
English Synonyms: | D-BETA-T-BUTYLSERINE |
MDL Number.: | MFCD11558926 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | C[C@H]([C@H](C(=O)O)N)C(C)(C)C |
InChi: | InChI=1S/C8H17NO2/c1-5(8(2,3)4)6(9)7(10)11/h5-6H,9H2,1-4H3,(H,10,11)/t5-,6-/m1/s1 |
InChiKey: | InChIKey=VSVANDHBXJEGCX-PHDIDXHHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.