* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PD-85639 |
| CAS: | 150034-24-5 |
| English Synonyms: | PD-85639 |
| MDL Number.: | MFCD14635427 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1CCCC(N1CCCNC(=O)C(c2ccccc2)c3ccccc3)C |
| InChi: | InChI=1S/C24H32N2O/c1-19-11-9-12-20(2)26(19)18-10-17-25-24(27)23(21-13-5-3-6-14-21)22-15-7-4-8-16-22/h3-8,13-16,19-20,23H,9-12,17-18H2,1-2H3,(H,25,27) |
| InChiKey: | InChIKey=BPZBEIHSHWNWTE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.