* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABBYPHARMA AP-13-5159 |
| English Synonyms: | ABBYPHARMA AP-13-5159 |
| MDL Number.: | MFCD16988647 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1cc(cc(n1)C)OC(=O)c2ccccc2.Cl |
| InChi: | InChI=1S/C14H13NO2.ClH/c1-10-8-13(9-11(2)15-10)17-14(16)12-6-4-3-5-7-12;/h3-9H,1-2H3;1H |
| InChiKey: | InChIKey=IBYDTHJGOZGQHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.