* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KH CB19 |
| English Synonyms: | KH CB19 |
| MDL Number.: | MFCD20926346 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)c1c(c2ccc(c(c2n1C)Cl)Cl)/C(=C\N)/C#N |
| InChi: | InChI=1S/C15H13Cl2N3O2/c1-3-22-15(21)14-11(8(6-18)7-19)9-4-5-10(16)12(17)13(9)20(14)2/h4-6H,3,18H2,1-2H3/b8-6- |
| InChiKey: | InChIKey=CXJCGSPAPOTTSF-VURMDHGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.