* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1172 |
English Synonyms: | ABBYPHARMA AP-10-1172 |
MDL Number.: | MFCD16987914 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1nc(c(c(n1)[O-])F)c2ccccc2.[Na+] |
InChi: | InChI=1S/C11H9FN2O.Na/c1-7-13-10(9(12)11(15)14-7)8-5-3-2-4-6-8;/h2-6H,1H3,(H,13,14,15);/q;+1/p-1 |
InChiKey: | InChIKey=NKFDOORJWLJACG-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.