* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33223747 |
English Synonyms: | UKRORGSYN-BB BBV-33223747 |
MDL Number.: | MFCD16666070 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C1CC1CC(=O)N(CC/C(=N\O)/N)C2CC2 |
InChi: | InChI=1S/C11H19N3O2/c12-10(13-16)5-6-14(9-3-4-9)11(15)7-8-1-2-8/h8-9,16H,1-7H2,(H2,12,13) |
InChiKey: | InChIKey=ROMADPQYSFIDIY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.