* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33369657 |
English Synonyms: | UKRORGSYN-BB BBV-33369657 |
MDL Number.: | MFCD16666096 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)C[C@H](C(=O)O)NC(=O)CC1CC1 |
InChi: | InChI=1S/C11H19NO3/c1-7(2)5-9(11(14)15)12-10(13)6-8-3-4-8/h7-9H,3-6H2,1-2H3,(H,12,13)(H,14,15)/t9-/m1/s1 |
InChiKey: | InChIKey=AYJVTJUSWKZFHP-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.