* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33721783 |
English Synonyms: | UKRORGSYN-BB BBV-33721783 |
MDL Number.: | MFCD16666124 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | COCCC(C)NC(C)C1CC2CCC1C2 |
InChi: | InChI=1S/C14H27NO/c1-10(6-7-16-3)15-11(2)14-9-12-4-5-13(14)8-12/h10-15H,4-9H2,1-3H3 |
InChiKey: | InChIKey=AWAZZXXXGPMBPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.