* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33810830 |
English Synonyms: | UKRORGSYN-BB BBV-33810830 |
MDL Number.: | MFCD16666646 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(ccc1n2cc(nn2)CN)I |
InChi: | InChI=1S/C9H9IN4/c10-7-1-3-9(4-2-7)14-6-8(5-11)12-13-14/h1-4,6H,5,11H2 |
InChiKey: | InChIKey=UAMINMBKLRBNDE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.