* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-41219042 |
English Synonyms: | UKRORGSYN-BB BBV-41219042 |
MDL Number.: | MFCD16666686 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1c(nnn1C2CS(=O)(=O)CC2O)CN |
InChi: | InChI=1S/C7H12N4O3S/c8-1-5-2-11(10-9-5)6-3-15(13,14)4-7(6)12/h2,6-7,12H,1,3-4,8H2 |
InChiKey: | InChIKey=LGUCQQVQBBMWES-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.