* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-33811380 |
| English Synonyms: | UKRORGSYN-BB BBV-33811380 |
| MDL Number.: | MFCD16667126 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | NC1CCN(C1)C(=O)C1=CN=NS1 |
| InChi: | InChI=1S/C7H10N4OS/c8-5-1-2-11(4-5)7(12)6-3-9-10-13-6/h3,5H,1-2,4,8H2 |
| InChiKey: | InChIKey=AGJYLBDIYOKKPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.