* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811511 |
English Synonyms: | UKRORGSYN-BB BBV-33811511 |
MDL Number.: | MFCD16667240 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | NC1CCN(C1)S(=O)(=O)C1=CNC=C1 |
InChi: | InChI=1S/C8H13N3O2S/c9-7-2-4-11(6-7)14(12,13)8-1-3-10-5-8/h1,3,5,7,10H,2,4,6,9H2 |
InChiKey: | InChIKey=QKSVCTHBULKQTI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.