* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811583 |
English Synonyms: | UKRORGSYN-BB BBV-33811583 |
MDL Number.: | MFCD16667295 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | NC1CCN(CC(=O)C2=CC=CN2)C1 |
InChi: | InChI=1S/C10H15N3O/c11-8-3-5-13(6-8)7-10(14)9-2-1-4-12-9/h1-2,4,8,12H,3,5-7,11H2 |
InChiKey: | InChIKey=FTVFHWIGDWOHLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.