* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33811647 |
English Synonyms: | UKRORGSYN-BB BBV-33811647 |
MDL Number.: | MFCD16667354 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | NC1CCN(CC2=NN=NN2C2CC2)C1 |
InChi: | InChI=1S/C9H16N6/c10-7-3-4-14(5-7)6-9-11-12-13-15(9)8-1-2-8/h7-8H,1-6,10H2 |
InChiKey: | InChIKey=HRALGANBBFALBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.