* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812252 |
English Synonyms: | UKRORGSYN-BB BBV-33812252 |
MDL Number.: | MFCD16667883 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1cc(cn1)S(=O)(=O)N(C)CCCN |
InChi: | InChI=1S/C8H16N4O2S/c1-11-7-8(6-10-11)15(13,14)12(2)5-3-4-9/h6-7H,3-5,9H2,1-2H3 |
InChiKey: | InChIKey=TWALDCKHQRZPIQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.