* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812270 |
English Synonyms: | UKRORGSYN-BB BBV-33812270 |
MDL Number.: | MFCD16667899 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1nc(cn1C)S(=O)(=O)NCC#N |
InChi: | InChI=1S/C7H10N4O2S/c1-6-10-7(5-11(6)2)14(12,13)9-4-3-8/h5,9H,4H2,1-2H3 |
InChiKey: | InChIKey=KGOGDFVIRHEGOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.