* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812280 |
English Synonyms: | UKRORGSYN-BB BBV-33812280 |
MDL Number.: | MFCD16667909 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | Cc1nc(cn1C)S(=O)(=O)NCC(=S)N |
InChi: | InChI=1S/C7H12N4O2S2/c1-5-10-7(4-11(5)2)15(12,13)9-3-6(8)14/h4,9H,3H2,1-2H3,(H2,8,14) |
InChiKey: | InChIKey=RVWWLQLSXHLDMY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.