* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-33812283 |
English Synonyms: | UKRORGSYN-BB BBV-33812283 |
MDL Number.: | MFCD16667911 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1cc(cn1)S(=O)(=O)N(C)CC(=S)N |
InChi: | InChI=1S/C7H12N4O2S2/c1-10-4-6(3-9-10)15(12,13)11(2)5-7(8)14/h3-4H,5H2,1-2H3,(H2,8,14) |
InChiKey: | InChIKey=BTAWCXOAPINBTF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.