* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-33812823 |
| English Synonyms: | UKRORGSYN-BB BBV-33812823 |
| MDL Number.: | MFCD16668409 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCNC(CN)c1c(ccs1)C |
| InChi: | InChI=1S/C9H16N2S/c1-3-11-8(6-10)9-7(2)4-5-12-9/h4-5,8,11H,3,6,10H2,1-2H3 |
| InChiKey: | InChIKey=DMKCFWOFVWGMFB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.