* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34224465 |
English Synonyms: | UKRORGSYN-BB BBV-34224465 |
MDL Number.: | MFCD16749977 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CC1CC1NC2CC3CC2C4C3CCC4 |
InChi: | InChI=1S/C14H23N/c1-8-5-13(8)15-14-7-9-6-12(14)11-4-2-3-10(9)11/h8-15H,2-7H2,1H3 |
InChiKey: | InChIKey=KLSJUOBKVSTJHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.