* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225120 |
English Synonyms: | UKRORGSYN-BB BBV-34225120 |
MDL Number.: | MFCD16750613 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC1CC1Nc2nccn2C |
InChi: | InChI=1S/C8H13N3/c1-6-5-7(6)10-8-9-3-4-11(8)2/h3-4,6-7H,5H2,1-2H3,(H,9,10) |
InChiKey: | InChIKey=XOMJSLQCWNBBPR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.