* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225122 |
English Synonyms: | UKRORGSYN-BB BBV-34225122 |
MDL Number.: | MFCD16750615 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1ccnc1NC2CC2C |
InChi: | InChI=1S/C9H15N3/c1-3-12-5-4-10-9(12)11-8-6-7(8)2/h4-5,7-8H,3,6H2,1-2H3,(H,10,11) |
InChiKey: | InChIKey=XEEKVZAOSSIYJS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.