* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34225775 |
| English Synonyms: | UKRORGSYN-BB BBV-34225775 |
| MDL Number.: | MFCD16751212 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCc1cc(n(n1)C(C)C2CC2)S |
| InChi: | InChI=1S/C10H16N2S/c1-3-9-6-10(13)12(11-9)7(2)8-4-5-8/h6-8,13H,3-5H2,1-2H3 |
| InChiKey: | InChIKey=ZCWOSTWBQSUCIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.