* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225778 |
English Synonyms: | UKRORGSYN-BB BBV-34225778 |
MDL Number.: | MFCD16751215 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCn1c(cc(n1)c2ccccc2)S |
InChi: | InChI=1S/C11H12N2S/c1-2-13-11(14)8-10(12-13)9-6-4-3-5-7-9/h3-8,14H,2H2,1H3 |
InChiKey: | InChIKey=GKADCOBNLAIBQF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.