* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34225791 |
English Synonyms: | UKRORGSYN-BB BBV-34225791 |
MDL Number.: | MFCD16751227 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCCn1c(cc(n1)CC)S |
InChi: | InChI=1S/C8H14N2S/c1-3-5-10-8(11)6-7(4-2)9-10/h6,11H,3-5H2,1-2H3 |
InChiKey: | InChIKey=RSORYBWJFYVWIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.