* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34225812 |
| English Synonyms: | UKRORGSYN-BB BBV-34225812 |
| MDL Number.: | MFCD16751244 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)CCn1c(cc(n1)C(C)C)S |
| InChi: | InChI=1S/C11H20N2S/c1-8(2)5-6-13-11(14)7-10(12-13)9(3)4/h7-9,14H,5-6H2,1-4H3 |
| InChiKey: | InChIKey=FVNKALGMYNYMDP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.