* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34247136 |
English Synonyms: | UKRORGSYN-BB BBV-34247136 |
MDL Number.: | MFCD16753120 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CC(C(=O)OC)NC(=N)Nc1ccccc1 |
InChi: | InChI=1S/C11H15N3O2/c1-8(10(15)16-2)13-11(12)14-9-6-4-3-5-7-9/h3-8H,1-2H3,(H3,12,13,14) |
InChiKey: | InChIKey=DCDLJUDBTMQUAK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.