* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34247143 |
English Synonyms: | UKRORGSYN-BB BBV-34247143 |
MDL Number.: | MFCD16753121 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | CCNC(=O)CNC(=N)NC1CCCCC1 |
InChi: | InChI=1S/C11H22N4O/c1-2-13-10(16)8-14-11(12)15-9-6-4-3-5-7-9/h9H,2-8H2,1H3,(H,13,16)(H3,12,14,15) |
InChiKey: | InChIKey=SFWNABIOSRCBBA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.