* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34257032 |
English Synonyms: | UKRORGSYN-BB BBV-34257032 |
MDL Number.: | MFCD16754326 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCC(CC)n1c2cc(ccc2nc1S)F |
InChi: | InChI=1S/C12H15FN2S/c1-3-9(4-2)15-11-7-8(13)5-6-10(11)14-12(15)16/h5-7,9H,3-4H2,1-2H3,(H,14,16) |
InChiKey: | InChIKey=MIRRFJIBNMRIRL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.