* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34269941 |
English Synonyms: | UKRORGSYN-BB BBV-34269941 |
MDL Number.: | MFCD16755522 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CCc1ccccc1CNCc2[nH]cnn2 |
InChi: | InChI=1S/C12H16N4/c1-2-10-5-3-4-6-11(10)7-13-8-12-14-9-15-16-12/h3-6,9,13H,2,7-8H2,1H3,(H,14,15,16) |
InChiKey: | InChIKey=KRFGSGWSGHDJPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.