* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-39145129 |
| English Synonyms: | UKRORGSYN-BB BBV-39145129 |
| MDL Number.: | MFCD16755527 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CCc1ccccc1CNCc2cc[nH]n2 |
| InChi: | InChI=1S/C13H17N3/c1-2-11-5-3-4-6-12(11)9-14-10-13-7-8-15-16-13/h3-8,14H,2,9-10H2,1H3,(H,15,16) |
| InChiKey: | InChIKey=DCNKGVXPWYLOMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.