* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34272671 |
| English Synonyms: | UKRORGSYN-BB BBV-34272671 |
| MDL Number.: | MFCD16756135 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(COC)NC(=O)Cn1cc(nn1)CO |
| InChi: | InChI=1S/C9H16N4O3/c1-7(6-16-2)10-9(15)4-13-3-8(5-14)11-12-13/h3,7,14H,4-6H2,1-2H3,(H,10,15) |
| InChiKey: | InChIKey=OZYLMPZZEDXXJD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.