* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34272687 |
| English Synonyms: | UKRORGSYN-BB BBV-34272687 |
| MDL Number.: | MFCD16756137 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COCCCNC(=O)Cn1cc(nn1)CO |
| InChi: | InChI=1S/C9H16N4O3/c1-16-4-2-3-10-9(15)6-13-5-8(7-14)11-12-13/h5,14H,2-4,6-7H2,1H3,(H,10,15) |
| InChiKey: | InChIKey=QSWBGNZYSIIJHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.