* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34272725 |
| English Synonyms: | UKRORGSYN-BB BBV-34272725 |
| MDL Number.: | MFCD16756142 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)NC(=O)Cn1cc(nn1)CO |
| InChi: | InChI=1S/C8H12N4O4/c1-2-16-8(15)9-7(14)4-12-3-6(5-13)10-11-12/h3,13H,2,4-5H2,1H3,(H,9,14,15) |
| InChiKey: | InChIKey=NANRILKGWQWZEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.