* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34272727 |
English Synonyms: | UKRORGSYN-BB BBV-34272727 |
MDL Number.: | MFCD16756143 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CCNC(=O)NC(=O)Cn1cc(nn1)CO |
InChi: | InChI=1S/C8H13N5O3/c1-2-9-8(16)10-7(15)4-13-3-6(5-14)11-12-13/h3,14H,2,4-5H2,1H3,(H2,9,10,15,16) |
InChiKey: | InChIKey=KNEVIXCFYZVEIC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.