* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34272798 |
| English Synonyms: | UKRORGSYN-BB BBV-34272798 |
| MDL Number.: | MFCD16756149 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CCCn1c(nnn1)Cn2cc(nn2)CO |
| InChi: | InChI=1S/C8H13N7O/c1-2-3-15-8(10-11-13-15)5-14-4-7(6-16)9-12-14/h4,16H,2-3,5-6H2,1H3 |
| InChiKey: | InChIKey=FJJOPGNHNGTUPR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.