* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273050 |
| English Synonyms: | UKRORGSYN-BB BBV-34273050 |
| MDL Number.: | MFCD16756162 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)C(Cn2cc(nn2)CO)O |
| InChi: | InChI=1S/C11H13N3O2/c15-8-10-6-14(13-12-10)7-11(16)9-4-2-1-3-5-9/h1-6,11,15-16H,7-8H2 |
| InChiKey: | InChIKey=UDKDTUWZUXENOZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.