* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273060 |
| English Synonyms: | UKRORGSYN-BB BBV-34273060 |
| MDL Number.: | MFCD16756164 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1cn(cn1)CCCn2cc(nn2)CCO |
| InChi: | InChI=1S/C10H15N5O/c16-7-2-10-8-15(13-12-10)5-1-4-14-6-3-11-9-14/h3,6,8-9,16H,1-2,4-5,7H2 |
| InChiKey: | InChIKey=QCYZTNOSMHXQOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.