* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34273113 |
English Synonyms: | UKRORGSYN-BB BBV-34273113 |
MDL Number.: | MFCD16756178 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCCCNC(=O)Cn1cc(nn1)CCO |
InChi: | InChI=1S/C10H18N4O2/c1-2-3-5-11-10(16)8-14-7-9(4-6-15)12-13-14/h7,15H,2-6,8H2,1H3,(H,11,16) |
InChiKey: | InChIKey=MZNVFNNCQJGTCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.