* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34273115 |
English Synonyms: | UKRORGSYN-BB BBV-34273115 |
MDL Number.: | MFCD16756180 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | c1c(nnn1CCN2CCNC2=O)CCO |
InChi: | InChI=1S/C9H15N5O2/c15-6-1-8-7-14(12-11-8)5-4-13-3-2-10-9(13)16/h7,15H,1-6H2,(H,10,16) |
InChiKey: | InChIKey=PUMTYMYAWIIJEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.