* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273156 |
| English Synonyms: | UKRORGSYN-BB BBV-34273156 |
| MDL Number.: | MFCD16756191 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCc1ccc(s1)Cn2cc(nn2)CCO |
| InChi: | InChI=1S/C11H15N3OS/c1-2-10-3-4-11(16-10)8-14-7-9(5-6-15)12-13-14/h3-4,7,15H,2,5-6,8H2,1H3 |
| InChiKey: | InChIKey=SLUVBLYBGQHSNQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.