* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273161 |
| English Synonyms: | UKRORGSYN-BB BBV-34273161 |
| MDL Number.: | MFCD16756194 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCc1nnc(o1)Cn2cc(nn2)CCO |
| InChi: | InChI=1S/C9H13N5O2/c1-2-8-11-12-9(16-8)6-14-5-7(3-4-15)10-13-14/h5,15H,2-4,6H2,1H3 |
| InChiKey: | InChIKey=AFAGSNPOPHIFBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.