* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273271 |
| English Synonyms: | UKRORGSYN-BB BBV-34273271 |
| MDL Number.: | MFCD16756205 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | COCCNC(=O)Cn1cc(nn1)CCO |
| InChi: | InChI=1S/C9H16N4O3/c1-16-5-3-10-9(15)7-13-6-8(2-4-14)11-12-13/h6,14H,2-5,7H2,1H3,(H,10,15) |
| InChiKey: | InChIKey=QAYUIQPZOWTFSA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.