* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UKRORGSYN-BB BBV-34273283 |
| English Synonyms: | UKRORGSYN-BB BBV-34273283 |
| MDL Number.: | MFCD16756206 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | CNC(=O)NC(=O)Cn1cc(nn1)CCO |
| InChi: | InChI=1S/C8H13N5O3/c1-9-8(16)10-7(15)5-13-4-6(2-3-14)11-12-13/h4,14H,2-3,5H2,1H3,(H2,9,10,15,16) |
| InChiKey: | InChIKey=NSFSOBYSSDVETA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.