* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34278847 |
English Synonyms: | UKRORGSYN-BB BBV-34278847 |
MDL Number.: | MFCD16757400 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCn1cc(c(n1)N)S(=O)(=O)NC2CC2C |
InChi: | InChI=1S/C9H16N4O2S/c1-3-13-5-8(9(10)11-13)16(14,15)12-7-4-6(7)2/h5-7,12H,3-4H2,1-2H3,(H2,10,11) |
InChiKey: | InChIKey=ZACVPLIXJMJDPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.