* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34281764 |
English Synonyms: | UKRORGSYN-BB BBV-34281764 |
MDL Number.: | MFCD16757988 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCCOC(=O)CSc1cc(nn1C)C |
InChi: | InChI=1S/C11H18N2O2S/c1-4-5-6-15-11(14)8-16-10-7-9(2)12-13(10)3/h7H,4-6,8H2,1-3H3 |
InChiKey: | InChIKey=MIYAKKBTQVGFEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.