* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | UKRORGSYN-BB BBV-34304250 |
English Synonyms: | UKRORGSYN-BB BBV-34304250 |
MDL Number.: | MFCD16770559 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CCn1ccnc1NC(C)C2CCCCC2 |
InChi: | InChI=1S/C13H23N3/c1-3-16-10-9-14-13(16)15-11(2)12-7-5-4-6-8-12/h9-12H,3-8H2,1-2H3,(H,14,15) |
InChiKey: | InChIKey=LWZNUPGCUJUEJX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.